C25H20FN3O3 — CID 3897385
N-[(2,3-dimethoxyphenyl)methylideneamino]-2-(4-fluorophenyl)quinoline-4-carboxamide (PubChem CID 3897385) has the molecular formula C25H20FN3O3 and a molecular weight of 429.45 g/mol. Its IUPAC name is N-[(2,3-dimethoxyphenyl)methylideneamino]-2-(4-fluorophenyl)quinoline-4-carboxamide.
| Compound Name | N-[(2,3-dimethoxyphenyl)methylideneamino]-2-(4-fluorophenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 3897385 |
| Molecular Formula | C25H20FN3O3 |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | N-[(2,3-dimethoxyphenyl)methylideneamino]-2-(4-fluorophenyl)quinoline-4-carboxamide |
| SMILES | COc1cccc(C=NNC(=O)c2cc(-c3ccc(F)cc3)nc3ccccc23)c1OC |
| InChI | InChI=1S/C25H20FN3O3/c1-31-23-9-5-6-17(24(23)32-2)15-27-29-25(30)20-14-22(16-10-12-18(26)13-11-16)28-21-8-4-3-7-19(20)21/h3-15H,1-2H3,(H,29,30) |
| InChIKey | PGBRKIYJUYJBMQ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|