C23H11F6N3O — CID 16553728
2-(4-fluorophenyl)-N-[(E)-(2,3,4,5,6-pentafluorophenyl)methylideneamino]quinoline-4-carboxamide (PubChem CID 16553728) has the molecular formula C23H11F6N3O and a molecular weight of 459.35 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-[(E)-(2,3,4,5,6-pentafluorophenyl)methylideneamino]quinoline-4-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-N-[(E)-(2,3,4,5,6-pentafluorophenyl)methylideneamino]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 16553728 |
| Molecular Formula | C23H11F6N3O |
| Molecular Weight | 459.35 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | 2-(4-fluorophenyl)-N-[(E)-(2,3,4,5,6-pentafluorophenyl)methylideneamino]quinoline-4-carboxamide |
| SMILES | O=C(N/N=C/c1c(F)c(F)c(F)c(F)c1F)c1cc(-c2ccc(F)cc2)nc2ccccc12 |
| InChI | InChI=1S/C23H11F6N3O/c24-12-7-5-11(6-8-12)17-9-14(13-3-1-2-4-16(13)31-17)23(33)32-30-10-15-18(25)20(27)22(29)21(28)19(15)26/h1-10H,(H,32,33)/b30-10+ |
| InChIKey | RTJOUXQKWBGWLW-WXMAUWIXSA-N |
| XLogP | 5.50 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.35 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|