C23H14ClFN4O4 — CID 3469797
N-[(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-2-(4-fluorophenyl)quinoline-4-carboxamide (PubChem CID 3469797) has the molecular formula C23H14ClFN4O4 and a molecular weight of 464.84 g/mol. Its IUPAC name is N-[(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-2-(4-fluorophenyl)quinoline-4-carboxamide.
| Compound Name | N-[(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-2-(4-fluorophenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 3469797 |
| Molecular Formula | C23H14ClFN4O4 |
| Molecular Weight | 464.84 g/mol |
| Exact Mass | 464.07 |
| IUPAC Name | N-[(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-2-(4-fluorophenyl)quinoline-4-carboxamide |
| SMILES | O=C(NN=Cc1cc(Cl)cc([N+](=O)[O-])c1O)c1cc(-c2ccc(F)cc2)nc2ccccc12 |
| InChI | InChI=1S/C23H14ClFN4O4/c24-15-9-14(22(30)21(10-15)29(32)33)12-26-28-23(31)18-11-20(13-5-7-16(25)8-6-13)27-19-4-2-1-3-17(18)19/h1-12,30H,(H,28,31) |
| InChIKey | ILEUPCJBIJZENE-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 117.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.84 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|