C24H17ClN4O3 — CID 16959593
N-[(E)-(4-chloro-3-nitrophenyl)methylideneamino]-2-(4-methylphenyl)quinoline-4-carboxamide (PubChem CID 16959593) has the molecular formula C24H17ClN4O3 and a molecular weight of 444.88 g/mol. Its IUPAC name is N-[(E)-(4-chloro-3-nitrophenyl)methylideneamino]-2-(4-methylphenyl)quinoline-4-carboxamide.
| Compound Name | N-[(E)-(4-chloro-3-nitrophenyl)methylideneamino]-2-(4-methylphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 16959593 |
| Molecular Formula | C24H17ClN4O3 |
| Molecular Weight | 444.88 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | N-[(E)-(4-chloro-3-nitrophenyl)methylideneamino]-2-(4-methylphenyl)quinoline-4-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(=O)N/N=C/c3ccc(Cl)c([N+](=O)[O-])c3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C24H17ClN4O3/c1-15-6-9-17(10-7-15)22-13-19(18-4-2-3-5-21(18)27-22)24(30)28-26-14-16-8-11-20(25)23(12-16)29(31)32/h2-14H,1H3,(H,28,30)/b26-14+ |
| InChIKey | OQLDQJACKSFQQJ-VULFUBBASA-N |
| XLogP | 5.54 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.88 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|