C23H17N5O3 — CID 9078656
N-[(Z)-(4-methyl-3-nitrophenyl)methylideneamino]-2-pyridin-2-ylquinoline-4-carboxamide (PubChem CID 9078656) has the molecular formula C23H17N5O3 and a molecular weight of 411.42 g/mol. Its IUPAC name is N-[(Z)-(4-methyl-3-nitrophenyl)methylideneamino]-2-pyridin-2-ylquinoline-4-carboxamide.
| Compound Name | N-[(Z)-(4-methyl-3-nitrophenyl)methylideneamino]-2-pyridin-2-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 9078656 |
| Molecular Formula | C23H17N5O3 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | N-[(Z)-(4-methyl-3-nitrophenyl)methylideneamino]-2-pyridin-2-ylquinoline-4-carboxamide |
| SMILES | Cc1ccc(/C=N\NC(=O)c2cc(-c3ccccn3)nc3ccccc23)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H17N5O3/c1-15-9-10-16(12-22(15)28(30)31)14-25-27-23(29)18-13-21(20-8-4-5-11-24-20)26-19-7-3-2-6-17(18)19/h2-14H,1H3,(H,27,29)/b25-14- |
| InChIKey | KSPRGSYSDJHJNQ-QFEZKATASA-N |
| XLogP | 4.28 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|