C25H20FN3O4 — CID 3482852
2-(4-fluorophenyl)-N-[(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]quinoline-4-carboxamide (PubChem CID 3482852) has the molecular formula C25H20FN3O4 and a molecular weight of 445.45 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-[(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]quinoline-4-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-N-[(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 3482852 |
| Molecular Formula | C25H20FN3O4 |
| Molecular Weight | 445.45 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | 2-(4-fluorophenyl)-N-[(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]quinoline-4-carboxamide |
| SMILES | COc1cc(C=NNC(=O)c2cc(-c3ccc(F)cc3)nc3ccccc23)cc(OC)c1O |
| InChI | InChI=1S/C25H20FN3O4/c1-32-22-11-15(12-23(33-2)24(22)30)14-27-29-25(31)19-13-21(16-7-9-17(26)10-8-16)28-20-6-4-3-5-18(19)20/h3-14,30H,1-2H3,(H,29,31) |
| InChIKey | KVPKFNCZKKSHSB-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 93.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.45 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|