C26H22IN3O3 — CID 126046719
N-[(Z)-(4-ethoxy-3-iodo-5-methoxyphenyl)methylideneamino]-2-phenylquinoline-4-carboxamide (PubChem CID 126046719) has the molecular formula C26H22IN3O3 and a molecular weight of 551.38 g/mol. Its IUPAC name is N-[(Z)-(4-ethoxy-3-iodo-5-methoxyphenyl)methylideneamino]-2-phenylquinoline-4-carboxamide.
| Compound Name | N-[(Z)-(4-ethoxy-3-iodo-5-methoxyphenyl)methylideneamino]-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 126046719 |
| Molecular Formula | C26H22IN3O3 |
| Molecular Weight | 551.38 g/mol |
| Exact Mass | 551.07 |
| IUPAC Name | N-[(Z)-(4-ethoxy-3-iodo-5-methoxyphenyl)methylideneamino]-2-phenylquinoline-4-carboxamide |
| SMILES | CCOc1c(I)cc(/C=N\NC(=O)c2cc(-c3ccccc3)nc3ccccc23)cc1OC |
| InChI | InChI=1S/C26H22IN3O3/c1-3-33-25-21(27)13-17(14-24(25)32-2)16-28-30-26(31)20-15-23(18-9-5-4-6-10-18)29-22-12-8-7-11-19(20)22/h4-16H,3H2,1-2H3,(H,30,31)/b28-16- |
| InChIKey | YFALITJUDHHDJC-NTFVMDSBSA-N |
| XLogP | 5.68 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.38 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|