C26H19IN4O3 — CID 126055715
N-[(E)-[4-(cyanomethoxy)-3-iodo-5-methoxyphenyl]methylideneamino]-2-phenylquinoline-4-carboxamide (PubChem CID 126055715) has the molecular formula C26H19IN4O3 and a molecular weight of 562.37 g/mol. Its IUPAC name is N-[(E)-[4-(cyanomethoxy)-3-iodo-5-methoxyphenyl]methylideneamino]-2-phenylquinoline-4-carboxamide.
| Compound Name | N-[(E)-[4-(cyanomethoxy)-3-iodo-5-methoxyphenyl]methylideneamino]-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 126055715 |
| Molecular Formula | C26H19IN4O3 |
| Molecular Weight | 562.37 g/mol |
| Exact Mass | 562.05 |
| IUPAC Name | N-[(E)-[4-(cyanomethoxy)-3-iodo-5-methoxyphenyl]methylideneamino]-2-phenylquinoline-4-carboxamide |
| SMILES | COc1cc(/C=N/NC(=O)c2cc(-c3ccccc3)nc3ccccc23)cc(I)c1OCC#N |
| InChI | InChI=1S/C26H19IN4O3/c1-33-24-14-17(13-21(27)25(24)34-12-11-28)16-29-31-26(32)20-15-23(18-7-3-2-4-8-18)30-22-10-6-5-9-19(20)22/h2-10,13-16H,12H2,1H3,(H,31,32)/b29-16+ |
| InChIKey | QEOCPWKMVBJLET-MUFRIFMGSA-N |
| XLogP | 5.18 |
| TPSA | 96.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.37 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|