C28H25N3O5 — CID 126045980
ethyl 2-[2-methoxy-4-[(E)-[(2-phenylquinoline-4-carbonyl)hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 126045980) has the molecular formula C28H25N3O5 and a molecular weight of 483.52 g/mol. Its IUPAC name is ethyl 2-[2-methoxy-4-[(E)-[(2-phenylquinoline-4-carbonyl)hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-methoxy-4-[(E)-[(2-phenylquinoline-4-carbonyl)hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126045980 |
| Molecular Formula | C28H25N3O5 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | ethyl 2-[2-methoxy-4-[(E)-[(2-phenylquinoline-4-carbonyl)hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(/C=N/NC(=O)c2cc(-c3ccccc3)nc3ccccc23)cc1OC |
| InChI | InChI=1S/C28H25N3O5/c1-3-35-27(32)18-36-25-14-13-19(15-26(25)34-2)17-29-31-28(33)22-16-24(20-9-5-4-6-10-20)30-23-12-8-7-11-21(22)23/h4-17H,3,18H2,1-2H3,(H,31,33)/b29-17+ |
| InChIKey | GZNCWVNSFAWWMD-STBIYBPSSA-N |
| XLogP | 4.62 |
| TPSA | 99.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|