C23H22N4O4 — CID 1388519
N-[[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methylideneamino]-2-cyclopropylquinoline-4-carboxamide (PubChem CID 1388519) has the molecular formula C23H22N4O4 and a molecular weight of 418.45 g/mol. Its IUPAC name is N-[[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methylideneamino]-2-cyclopropylquinoline-4-carboxamide.
| Compound Name | N-[[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methylideneamino]-2-cyclopropylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 1388519 |
| Molecular Formula | C23H22N4O4 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | N-[[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methylideneamino]-2-cyclopropylquinoline-4-carboxamide |
| SMILES | COc1cc(C=NNC(=O)c2cc(C3CC3)nc3ccccc23)ccc1OCC(N)=O |
| InChI | InChI=1S/C23H22N4O4/c1-30-21-10-14(6-9-20(21)31-13-22(24)28)12-25-27-23(29)17-11-19(15-7-8-15)26-18-5-3-2-4-16(17)18/h2-6,9-12,15H,7-8,13H2,1H3,(H2,24,28)(H,27,29) |
| InChIKey | KWAMXOJVIOGZAI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 115.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|