C20H16N4O3 — CID 6884339
2-cyclopropyl-N-[(E)-(3-nitrophenyl)methylideneamino]quinoline-4-carboxamide (PubChem CID 6884339) has the molecular formula C20H16N4O3 and a molecular weight of 360.37 g/mol. Its IUPAC name is 2-cyclopropyl-N-[(E)-(3-nitrophenyl)methylideneamino]quinoline-4-carboxamide.
| Compound Name | 2-cyclopropyl-N-[(E)-(3-nitrophenyl)methylideneamino]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 6884339 |
| Molecular Formula | C20H16N4O3 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 2-cyclopropyl-N-[(E)-(3-nitrophenyl)methylideneamino]quinoline-4-carboxamide |
| SMILES | O=C(N/N=C/c1cccc([N+](=O)[O-])c1)c1cc(C2CC2)nc2ccccc12 |
| InChI | InChI=1S/C20H16N4O3/c25-20(23-21-12-13-4-3-5-15(10-13)24(26)27)17-11-19(14-8-9-14)22-18-7-2-1-6-16(17)18/h1-7,10-12,14H,8-9H2,(H,23,25)/b21-12+ |
| InChIKey | CALKIQFWZCUJEF-CIAFOILYSA-N |
| XLogP | 3.78 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|