C19H15N3O3 — CID 9040689
2-cyclopropyl-N-(3-nitrophenyl)quinoline-4-carboxamide (PubChem CID 9040689) has the molecular formula C19H15N3O3 and a molecular weight of 333.35 g/mol. Its IUPAC name is 2-cyclopropyl-N-(3-nitrophenyl)quinoline-4-carboxamide.
| Compound Name | 2-cyclopropyl-N-(3-nitrophenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 9040689 |
| Molecular Formula | C19H15N3O3 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 2-cyclopropyl-N-(3-nitrophenyl)quinoline-4-carboxamide |
| SMILES | O=C(Nc1cccc([N+](=O)[O-])c1)c1cc(C2CC2)nc2ccccc12 |
| InChI | InChI=1S/C19H15N3O3/c23-19(20-13-4-3-5-14(10-13)22(24)25)16-11-18(12-8-9-12)21-17-7-2-1-6-15(16)17/h1-7,10-12H,8-9H2,(H,20,23) |
| InChIKey | SERSFCJVJKLGBZ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|