C31H24FN3O3 — CID 126046797
N-[(E)-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-2-phenylquinoline-4-carboxamide (PubChem CID 126046797) has the molecular formula C31H24FN3O3 and a molecular weight of 505.55 g/mol. Its IUPAC name is N-[(E)-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-2-phenylquinoline-4-carboxamide.
| Compound Name | N-[(E)-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 126046797 |
| Molecular Formula | C31H24FN3O3 |
| Molecular Weight | 505.55 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | N-[(E)-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-2-phenylquinoline-4-carboxamide |
| SMILES | COc1cc(/C=N/NC(=O)c2cc(-c3ccccc3)nc3ccccc23)ccc1OCc1ccccc1F |
| InChI | InChI=1S/C31H24FN3O3/c1-37-30-17-21(15-16-29(30)38-20-23-11-5-7-13-26(23)32)19-33-35-31(36)25-18-28(22-9-3-2-4-10-22)34-27-14-8-6-12-24(25)27/h2-19H,20H2,1H3,(H,35,36)/b33-19+ |
| InChIKey | YMKAYOXWRMSMPZ-HNSNBQBZSA-N |
| XLogP | 6.39 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.55 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|