C31H23FIN3O3 — CID 126042928
N-[(E)-[4-[(2-fluorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-2-phenylquinoline-4-carboxamide (PubChem CID 126042928) has the molecular formula C31H23FIN3O3 and a molecular weight of 631.45 g/mol. Its IUPAC name is N-[(E)-[4-[(2-fluorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-2-phenylquinoline-4-carboxamide.
| Compound Name | N-[(E)-[4-[(2-fluorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 126042928 |
| Molecular Formula | C31H23FIN3O3 |
| Molecular Weight | 631.45 g/mol |
| Exact Mass | 631.08 |
| IUPAC Name | N-[(E)-[4-[(2-fluorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-2-phenylquinoline-4-carboxamide |
| SMILES | COc1cc(/C=N/NC(=O)c2cc(-c3ccccc3)nc3ccccc23)cc(I)c1OCc1ccccc1F |
| InChI | InChI=1S/C31H23FIN3O3/c1-38-29-16-20(15-26(33)30(29)39-19-22-11-5-7-13-25(22)32)18-34-36-31(37)24-17-28(21-9-3-2-4-10-21)35-27-14-8-6-12-23(24)27/h2-18H,19H2,1H3,(H,36,37)/b34-18+ |
| InChIKey | RNWXGSCXZFVROE-FABQOPTDSA-N |
| XLogP | 7.00 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.45 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|