C32H24BrN3O5 — CID 126044534
4-[[2-bromo-6-methoxy-4-[(E)-[(2-phenylquinoline-4-carbonyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid (PubChem CID 126044534) has the molecular formula C32H24BrN3O5 and a molecular weight of 610.46 g/mol. Its IUPAC name is 4-[[2-bromo-6-methoxy-4-[(E)-[(2-phenylquinoline-4-carbonyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-bromo-6-methoxy-4-[(E)-[(2-phenylquinoline-4-carbonyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126044534 |
| Molecular Formula | C32H24BrN3O5 |
| Molecular Weight | 610.46 g/mol |
| Exact Mass | 609.09 |
| IUPAC Name | 4-[[2-bromo-6-methoxy-4-[(E)-[(2-phenylquinoline-4-carbonyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid |
| SMILES | COc1cc(/C=N/NC(=O)c2cc(-c3ccccc3)nc3ccccc23)cc(Br)c1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C32H24BrN3O5/c1-40-29-16-21(15-26(33)30(29)41-19-20-11-13-23(14-12-20)32(38)39)18-34-36-31(37)25-17-28(22-7-3-2-4-8-22)35-27-10-6-5-9-24(25)27/h2-18H,19H2,1H3,(H,36,37)(H,38,39)/b34-18+ |
| InChIKey | USLBXXKFHWGZJP-FABQOPTDSA-N |
| XLogP | 6.71 |
| TPSA | 110.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.46 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|