C32H25BrClN3O3 — CID 126047213
N-[(E)-[4-[(4-bromophenyl)methoxy]-3-chloro-5-ethoxyphenyl]methylideneamino]-2-phenylquinoline-4-carboxamide (PubChem CID 126047213) has the molecular formula C32H25BrClN3O3 and a molecular weight of 614.93 g/mol. Its IUPAC name is N-[(E)-[4-[(4-bromophenyl)methoxy]-3-chloro-5-ethoxyphenyl]methylideneamino]-2-phenylquinoline-4-carboxamide.
| Compound Name | N-[(E)-[4-[(4-bromophenyl)methoxy]-3-chloro-5-ethoxyphenyl]methylideneamino]-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 126047213 |
| Molecular Formula | C32H25BrClN3O3 |
| Molecular Weight | 614.93 g/mol |
| Exact Mass | 613.08 |
| IUPAC Name | N-[(E)-[4-[(4-bromophenyl)methoxy]-3-chloro-5-ethoxyphenyl]methylideneamino]-2-phenylquinoline-4-carboxamide |
| SMILES | CCOc1cc(/C=N/NC(=O)c2cc(-c3ccccc3)nc3ccccc23)cc(Cl)c1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C32H25BrClN3O3/c1-2-39-30-17-22(16-27(34)31(30)40-20-21-12-14-24(33)15-13-21)19-35-37-32(38)26-18-29(23-8-4-3-5-9-23)36-28-11-7-6-10-25(26)28/h3-19H,2,20H2,1H3,(H,37,38)/b35-19+ |
| InChIKey | IHBWHVHIKPCUMX-XZYGTATASA-N |
| XLogP | 8.06 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.93 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|