C30H20Br2IN3O2 — CID 126036516
N-[(Z)-[5-bromo-2-[(4-bromophenyl)methoxy]-3-iodophenyl]methylideneamino]-2-phenylquinoline-4-carboxamide (PubChem CID 126036516) has the molecular formula C30H20Br2IN3O2 and a molecular weight of 741.22 g/mol. Its IUPAC name is N-[(Z)-[5-bromo-2-[(4-bromophenyl)methoxy]-3-iodophenyl]methylideneamino]-2-phenylquinoline-4-carboxamide.
| Compound Name | N-[(Z)-[5-bromo-2-[(4-bromophenyl)methoxy]-3-iodophenyl]methylideneamino]-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 126036516 |
| Molecular Formula | C30H20Br2IN3O2 |
| Molecular Weight | 741.22 g/mol |
| Exact Mass | 738.90 |
| IUPAC Name | N-[(Z)-[5-bromo-2-[(4-bromophenyl)methoxy]-3-iodophenyl]methylideneamino]-2-phenylquinoline-4-carboxamide |
| SMILES | O=C(N/N=C\c1cc(Br)cc(I)c1OCc1ccc(Br)cc1)c1cc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C30H20Br2IN3O2/c31-22-12-10-19(11-13-22)18-38-29-21(14-23(32)15-26(29)33)17-34-36-30(37)25-16-28(20-6-2-1-3-7-20)35-27-9-5-4-8-24(25)27/h1-17H,18H2,(H,36,37)/b34-17- |
| InChIKey | CEAZJVRFLBVCNN-DLCNMLRHSA-N |
| XLogP | 8.37 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.22 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|