C30H19Br2Cl2N3O2 — CID 126043013
N-[(Z)-[3,5-dibromo-2-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2-phenylquinoline-4-carboxamide (PubChem CID 126043013) has the molecular formula C30H19Br2Cl2N3O2 and a molecular weight of 684.22 g/mol. Its IUPAC name is N-[(Z)-[3,5-dibromo-2-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2-phenylquinoline-4-carboxamide.
| Compound Name | N-[(Z)-[3,5-dibromo-2-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 126043013 |
| Molecular Formula | C30H19Br2Cl2N3O2 |
| Molecular Weight | 684.22 g/mol |
| Exact Mass | 680.92 |
| IUPAC Name | N-[(Z)-[3,5-dibromo-2-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2-phenylquinoline-4-carboxamide |
| SMILES | O=C(N/N=C\c1cc(Br)cc(Br)c1OCc1ccc(Cl)c(Cl)c1)c1cc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C30H19Br2Cl2N3O2/c31-21-13-20(29(24(32)14-21)39-17-18-10-11-25(33)26(34)12-18)16-35-37-30(38)23-15-28(19-6-2-1-3-7-19)36-27-9-5-4-8-22(23)27/h1-16H,17H2,(H,37,38)/b35-16- |
| InChIKey | RUWMFZDAVLXJTN-NKHVPTTDSA-N |
| XLogP | 9.08 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.22 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|