C23H15Br2N3O2 — CID 4504170
N-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-2-phenylquinoline-4-carboxamide (PubChem CID 4504170) has the molecular formula C23H15Br2N3O2 and a molecular weight of 525.20 g/mol. Its IUPAC name is N-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-2-phenylquinoline-4-carboxamide.
| Compound Name | N-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 4504170 |
| Molecular Formula | C23H15Br2N3O2 |
| Molecular Weight | 525.20 g/mol |
| Exact Mass | 522.95 |
| IUPAC Name | N-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-2-phenylquinoline-4-carboxamide |
| SMILES | O=C(NN=Cc1cc(Br)cc(Br)c1O)c1cc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C23H15Br2N3O2/c24-16-10-15(22(29)19(25)11-16)13-26-28-23(30)18-12-21(14-6-2-1-3-7-14)27-20-9-5-4-8-17(18)20/h1-13,29H,(H,28,30) |
| InChIKey | ODCDORRUJXBWCS-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.20 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|