C23H16Br2N4O2 — CID 135851245
N-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-3-(4-phenylphenyl)-1H-pyrazole-5-carboxamide (PubChem CID 135851245) has the molecular formula C23H16Br2N4O2 and a molecular weight of 540.22 g/mol. Its IUPAC name is N-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-3-(4-phenylphenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-3-(4-phenylphenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 135851245 |
| Molecular Formula | C23H16Br2N4O2 |
| Molecular Weight | 540.22 g/mol |
| Exact Mass | 537.96 |
| IUPAC Name | N-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-3-(4-phenylphenyl)-1H-pyrazole-5-carboxamide |
| SMILES | O=C(N/N=C/c1cc(Br)cc(Br)c1O)c1cc(-c2ccc(-c3ccccc3)cc2)n[nH]1 |
| InChI | InChI=1S/C23H16Br2N4O2/c24-18-10-17(22(30)19(25)11-18)13-26-29-23(31)21-12-20(27-28-21)16-8-6-15(7-9-16)14-4-2-1-3-5-14/h1-13,30H,(H,27,28)(H,29,31)/b26-13+ |
| InChIKey | HKZMVZOUZYGXMA-LGJNPRDNSA-N |
| XLogP | 5.74 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.22 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|