C18H14Br2N4O3 — CID 3832330
N-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-3-(4-methoxyphenyl)-1H-pyrazole-5-carboxamide (PubChem CID 3832330) has the molecular formula C18H14Br2N4O3 and a molecular weight of 494.14 g/mol. Its IUPAC name is N-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-3-(4-methoxyphenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-3-(4-methoxyphenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 3832330 |
| Molecular Formula | C18H14Br2N4O3 |
| Molecular Weight | 494.14 g/mol |
| Exact Mass | 491.94 |
| IUPAC Name | N-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-3-(4-methoxyphenyl)-1H-pyrazole-5-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)NN=Cc3cc(Br)cc(Br)c3O)[nH]n2)cc1 |
| InChI | InChI=1S/C18H14Br2N4O3/c1-27-13-4-2-10(3-5-13)15-8-16(23-22-15)18(26)24-21-9-11-6-12(19)7-14(20)17(11)25/h2-9,25H,1H3,(H,22,23)(H,24,26) |
| InChIKey | LJPFYEPUSIHFTR-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.14 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|