C31H23Cl2N3O3 — CID 126040006
N-[(Z)-[2-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-2-phenylquinoline-4-carboxamide (PubChem CID 126040006) has the molecular formula C31H23Cl2N3O3 and a molecular weight of 556.45 g/mol. Its IUPAC name is N-[(Z)-[2-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-2-phenylquinoline-4-carboxamide.
| Compound Name | N-[(Z)-[2-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 126040006 |
| Molecular Formula | C31H23Cl2N3O3 |
| Molecular Weight | 556.45 g/mol |
| Exact Mass | 555.11 |
| IUPAC Name | N-[(Z)-[2-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-2-phenylquinoline-4-carboxamide |
| SMILES | COc1cccc(/C=N\NC(=O)c2cc(-c3ccccc3)nc3ccccc23)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C31H23Cl2N3O3/c1-38-29-13-7-10-22(30(29)39-19-20-14-15-25(32)26(33)16-20)18-34-36-31(37)24-17-28(21-8-3-2-4-9-21)35-27-12-6-5-11-23(24)27/h2-18H,19H2,1H3,(H,36,37)/b34-18- |
| InChIKey | FOTRLJDPKLMWEM-HQDYHJHZSA-N |
| XLogP | 7.56 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.45 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|