C38H31N3O3 — CID 126051206
N-[(E)-[3-methoxy-4-(naphthalen-1-ylmethoxy)-5-prop-2-enylphenyl]methylideneamino]-2-phenylquinoline-4-carboxamide (PubChem CID 126051206) has the molecular formula C38H31N3O3 and a molecular weight of 577.68 g/mol. Its IUPAC name is N-[(E)-[3-methoxy-4-(naphthalen-1-ylmethoxy)-5-prop-2-enylphenyl]methylideneamino]-2-phenylquinoline-4-carboxamide.
| Compound Name | N-[(E)-[3-methoxy-4-(naphthalen-1-ylmethoxy)-5-prop-2-enylphenyl]methylideneamino]-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 126051206 |
| Molecular Formula | C38H31N3O3 |
| Molecular Weight | 577.68 g/mol |
| Exact Mass | 577.24 |
| IUPAC Name | N-[(E)-[3-methoxy-4-(naphthalen-1-ylmethoxy)-5-prop-2-enylphenyl]methylideneamino]-2-phenylquinoline-4-carboxamide |
| SMILES | C=CCc1cc(/C=N/NC(=O)c2cc(-c3ccccc3)nc3ccccc23)cc(OC)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C38H31N3O3/c1-3-12-29-21-26(22-36(43-2)37(29)44-25-30-17-11-16-27-13-7-8-18-31(27)30)24-39-41-38(42)33-23-35(28-14-5-4-6-15-28)40-34-20-10-9-19-32(33)34/h3-11,13-24H,1,12,25H2,2H3,(H,41,42)/b39-24+ |
| InChIKey | PBJKZHWJDBPIPT-HZQMBONKSA-N |
| XLogP | 8.14 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.68 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|