C26H20BrN3O4 — CID 126052906
methyl 2-[2-bromo-4-[(E)-[(2-phenylquinoline-4-carbonyl)hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 126052906) has the molecular formula C26H20BrN3O4 and a molecular weight of 518.37 g/mol. Its IUPAC name is methyl 2-[2-bromo-4-[(E)-[(2-phenylquinoline-4-carbonyl)hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[2-bromo-4-[(E)-[(2-phenylquinoline-4-carbonyl)hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126052906 |
| Molecular Formula | C26H20BrN3O4 |
| Molecular Weight | 518.37 g/mol |
| Exact Mass | 517.06 |
| IUPAC Name | methyl 2-[2-bromo-4-[(E)-[(2-phenylquinoline-4-carbonyl)hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(/C=N/NC(=O)c2cc(-c3ccccc3)nc3ccccc23)cc1Br |
| InChI | InChI=1S/C26H20BrN3O4/c1-33-25(31)16-34-24-12-11-17(13-21(24)27)15-28-30-26(32)20-14-23(18-7-3-2-4-8-18)29-22-10-6-5-9-19(20)22/h2-15H,16H2,1H3,(H,30,32)/b28-15+ |
| InChIKey | KIQQZQBXNSOGQP-RWPZCVJISA-N |
| XLogP | 4.98 |
| TPSA | 89.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.37 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|