C28H21N3O2 — CID 135533651
N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-2-(4-methylphenyl)quinoline-4-carboxamide (PubChem CID 135533651) has the molecular formula C28H21N3O2 and a molecular weight of 431.50 g/mol. Its IUPAC name is N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-2-(4-methylphenyl)quinoline-4-carboxamide.
| Compound Name | N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-2-(4-methylphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 135533651 |
| Molecular Formula | C28H21N3O2 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-2-(4-methylphenyl)quinoline-4-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(=O)N/N=C/c3c(O)ccc4ccccc34)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C28H21N3O2/c1-18-10-12-20(13-11-18)26-16-23(22-8-4-5-9-25(22)30-26)28(33)31-29-17-24-21-7-3-2-6-19(21)14-15-27(24)32/h2-17,32H,1H3,(H,31,33)/b29-17+ |
| InChIKey | KCSHIYILFJDNFF-STBIYBPSSA-N |
| XLogP | 5.83 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|