C23H18N4O — CID 6884131
N-[(E)-(6-methyl-2-pyridinyl)methylideneamino]-2-phenylquinoline-4-carboxamide (PubChem CID 6884131) has the molecular formula C23H18N4O and a molecular weight of 366.42 g/mol. Its IUPAC name is N-[(E)-(6-methyl-2-pyridinyl)methylideneamino]-2-phenylquinoline-4-carboxamide.
| Compound Name | N-[(E)-(6-methyl-2-pyridinyl)methylideneamino]-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 6884131 |
| Molecular Formula | C23H18N4O |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | N-[(E)-(6-methyl-2-pyridinyl)methylideneamino]-2-phenylquinoline-4-carboxamide |
| SMILES | Cc1cccc(/C=N/NC(=O)c2cc(-c3ccccc3)nc3ccccc23)n1 |
| InChI | InChI=1S/C23H18N4O/c1-16-8-7-11-18(25-16)15-24-27-23(28)20-14-22(17-9-3-2-4-10-17)26-21-13-6-5-12-19(20)21/h2-15H,1H3,(H,27,28)/b24-15+ |
| InChIKey | CIHZGOQVEJDBLF-BUVRLJJBSA-N |
| XLogP | 4.37 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|