C40H30N4O — CID 126037298
N-[(Z)-[1-(4-methylphenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]-2-phenylquinoline-4-carboxamide (PubChem CID 126037298) has the molecular formula C40H30N4O and a molecular weight of 582.71 g/mol. Its IUPAC name is N-[(Z)-[1-(4-methylphenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]-2-phenylquinoline-4-carboxamide.
| Compound Name | N-[(Z)-[1-(4-methylphenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 126037298 |
| Molecular Formula | C40H30N4O |
| Molecular Weight | 582.71 g/mol |
| Exact Mass | 582.24 |
| IUPAC Name | N-[(Z)-[1-(4-methylphenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]-2-phenylquinoline-4-carboxamide |
| SMILES | Cc1ccc(-n2c(-c3ccccc3)cc(/C=N\NC(=O)c3cc(-c4ccccc4)nc4ccccc34)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C40H30N4O/c1-28-21-23-33(24-22-28)44-38(30-15-7-3-8-16-30)25-32(39(44)31-17-9-4-10-18-31)27-41-43-40(45)35-26-37(29-13-5-2-6-14-29)42-36-20-12-11-19-34(35)36/h2-27H,1H3,(H,43,45)/b41-27- |
| InChIKey | IGWWBTKVZJBREG-CBALNBDPSA-N |
| XLogP | 9.10 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.71 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|