C35H27N5O3S — CID 126050255
N-[(E)-[2,5-dimethyl-1-[4-(4-nitrophenyl)sulfanylphenyl]pyrrol-3-yl]methylideneamino]-2-phenylquinoline-4-carboxamide (PubChem CID 126050255) has the molecular formula C35H27N5O3S and a molecular weight of 597.70 g/mol. Its IUPAC name is N-[(E)-[2,5-dimethyl-1-[4-(4-nitrophenyl)sulfanylphenyl]pyrrol-3-yl]methylideneamino]-2-phenylquinoline-4-carboxamide.
| Compound Name | N-[(E)-[2,5-dimethyl-1-[4-(4-nitrophenyl)sulfanylphenyl]pyrrol-3-yl]methylideneamino]-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 126050255 |
| Molecular Formula | C35H27N5O3S |
| Molecular Weight | 597.70 g/mol |
| Exact Mass | 597.18 |
| IUPAC Name | N-[(E)-[2,5-dimethyl-1-[4-(4-nitrophenyl)sulfanylphenyl]pyrrol-3-yl]methylideneamino]-2-phenylquinoline-4-carboxamide |
| SMILES | Cc1cc(/C=N/NC(=O)c2cc(-c3ccccc3)nc3ccccc23)c(C)n1-c1ccc(Sc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C35H27N5O3S/c1-23-20-26(24(2)39(23)27-12-16-29(17-13-27)44-30-18-14-28(15-19-30)40(42)43)22-36-38-35(41)32-21-34(25-8-4-3-5-9-25)37-33-11-7-6-10-31(32)33/h3-22H,1-2H3,(H,38,41)/b36-22+ |
| InChIKey | ZWOSCOHTMBALGV-HPNXWYHWSA-N |
| XLogP | 8.13 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.70 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|