C22H21N5O4 — CID 3568974
4-acetamido-N-[[2,5-dimethyl-1-(4-nitrophenyl)pyrrol-3-yl]methylideneamino]benzamide (PubChem CID 3568974) has the molecular formula C22H21N5O4 and a molecular weight of 419.44 g/mol. Its IUPAC name is 4-acetamido-N-[[2,5-dimethyl-1-(4-nitrophenyl)pyrrol-3-yl]methylideneamino]benzamide.
| Compound Name | 4-acetamido-N-[[2,5-dimethyl-1-(4-nitrophenyl)pyrrol-3-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 3568974 |
| Molecular Formula | C22H21N5O4 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 4-acetamido-N-[[2,5-dimethyl-1-(4-nitrophenyl)pyrrol-3-yl]methylideneamino]benzamide |
| SMILES | CC(=O)Nc1ccc(C(=O)NN=Cc2cc(C)n(-c3ccc([N+](=O)[O-])cc3)c2C)cc1 |
| InChI | InChI=1S/C22H21N5O4/c1-14-12-18(15(2)26(14)20-8-10-21(11-9-20)27(30)31)13-23-25-22(29)17-4-6-19(7-5-17)24-16(3)28/h4-13H,1-3H3,(H,24,28)(H,25,29) |
| InChIKey | NHHRTFQHAHZRAP-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 118.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|