C21H18BrN5O4 — CID 94837222
N'-[(Z)-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-N-(4-nitrophenyl)oxamide (PubChem CID 94837222) has the molecular formula C21H18BrN5O4 and a molecular weight of 484.31 g/mol. Its IUPAC name is N'-[(Z)-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-N-(4-nitrophenyl)oxamide.
| Compound Name | N'-[(Z)-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-N-(4-nitrophenyl)oxamide |
|---|---|
| PubChem CID | 94837222 |
| Molecular Formula | C21H18BrN5O4 |
| Molecular Weight | 484.31 g/mol |
| Exact Mass | 483.05 |
| IUPAC Name | N'-[(Z)-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-N-(4-nitrophenyl)oxamide |
| SMILES | Cc1cc(/C=N\NC(=O)C(=O)Nc2ccc([N+](=O)[O-])cc2)c(C)n1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H18BrN5O4/c1-13-11-15(14(2)26(13)18-7-3-16(22)4-8-18)12-23-25-21(29)20(28)24-17-5-9-19(10-6-17)27(30)31/h3-12H,1-2H3,(H,24,28)(H,25,29)/b23-12- |
| InChIKey | ZDWQZJFTNAOWDI-FMCGGJTJSA-N |
| XLogP | 3.85 |
| TPSA | 118.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.31 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|