C26H21BrN4O3 — CID 17245347
2-bromo-N-[(E)-[2,5-dimethyl-1-[4-(4-nitrophenyl)phenyl]pyrrol-3-yl]methylideneamino]benzamide (PubChem CID 17245347) has the molecular formula C26H21BrN4O3 and a molecular weight of 517.38 g/mol. Its IUPAC name is 2-bromo-N-[(E)-[2,5-dimethyl-1-[4-(4-nitrophenyl)phenyl]pyrrol-3-yl]methylideneamino]benzamide.
| Compound Name | 2-bromo-N-[(E)-[2,5-dimethyl-1-[4-(4-nitrophenyl)phenyl]pyrrol-3-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 17245347 |
| Molecular Formula | C26H21BrN4O3 |
| Molecular Weight | 517.38 g/mol |
| Exact Mass | 516.08 |
| IUPAC Name | 2-bromo-N-[(E)-[2,5-dimethyl-1-[4-(4-nitrophenyl)phenyl]pyrrol-3-yl]methylideneamino]benzamide |
| SMILES | Cc1cc(/C=N/NC(=O)c2ccccc2Br)c(C)n1-c1ccc(-c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C26H21BrN4O3/c1-17-15-21(16-28-29-26(32)24-5-3-4-6-25(24)27)18(2)30(17)22-11-7-19(8-12-22)20-9-13-23(14-10-20)31(33)34/h3-16H,1-2H3,(H,29,32)/b28-16+ |
| InChIKey | POKQTHCDGNQSLY-LQKURTRISA-N |
| XLogP | 6.20 |
| TPSA | 89.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.38 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|