C21H19BrN4O3 — CID 29147049
2-bromo-N-[(Z)-[2,5-dimethyl-1-(2-methyl-5-nitrophenyl)pyrrol-3-yl]methylideneamino]benzamide (PubChem CID 29147049) has the molecular formula C21H19BrN4O3 and a molecular weight of 455.31 g/mol. Its IUPAC name is 2-bromo-N-[(Z)-[2,5-dimethyl-1-(2-methyl-5-nitrophenyl)pyrrol-3-yl]methylideneamino]benzamide.
| Compound Name | 2-bromo-N-[(Z)-[2,5-dimethyl-1-(2-methyl-5-nitrophenyl)pyrrol-3-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 29147049 |
| Molecular Formula | C21H19BrN4O3 |
| Molecular Weight | 455.31 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | 2-bromo-N-[(Z)-[2,5-dimethyl-1-(2-methyl-5-nitrophenyl)pyrrol-3-yl]methylideneamino]benzamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1-n1c(C)cc(/C=N\NC(=O)c2ccccc2Br)c1C |
| InChI | InChI=1S/C21H19BrN4O3/c1-13-8-9-17(26(28)29)11-20(13)25-14(2)10-16(15(25)3)12-23-24-21(27)18-6-4-5-7-19(18)22/h4-12H,1-3H3,(H,24,27)/b23-12- |
| InChIKey | ZQMDZMUTVKPBHP-FMCGGJTJSA-N |
| XLogP | 4.84 |
| TPSA | 89.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.31 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|