C25H22N4O3 — CID 126006317
N-[(E)-[2,5-dimethyl-1-(2-methyl-4-nitrophenyl)pyrrol-3-yl]methylideneamino]naphthalene-2-carboxamide (PubChem CID 126006317) has the molecular formula C25H22N4O3 and a molecular weight of 426.48 g/mol. Its IUPAC name is N-[(E)-[2,5-dimethyl-1-(2-methyl-4-nitrophenyl)pyrrol-3-yl]methylideneamino]naphthalene-2-carboxamide.
| Compound Name | N-[(E)-[2,5-dimethyl-1-(2-methyl-4-nitrophenyl)pyrrol-3-yl]methylideneamino]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 126006317 |
| Molecular Formula | C25H22N4O3 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | N-[(E)-[2,5-dimethyl-1-(2-methyl-4-nitrophenyl)pyrrol-3-yl]methylideneamino]naphthalene-2-carboxamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1-n1c(C)cc(/C=N/NC(=O)c2ccc3ccccc3c2)c1C |
| InChI | InChI=1S/C25H22N4O3/c1-16-12-23(29(31)32)10-11-24(16)28-17(2)13-22(18(28)3)15-26-27-25(30)21-9-8-19-6-4-5-7-20(19)14-21/h4-15H,1-3H3,(H,27,30)/b26-15+ |
| InChIKey | SCANPCRQVHQDDL-CVKSISIWSA-N |
| XLogP | 5.23 |
| TPSA | 89.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|