C25H22N4O4 — CID 126008480
N-[(E)-[1-(2-methoxy-4-nitrophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]naphthalene-2-carboxamide (PubChem CID 126008480) has the molecular formula C25H22N4O4 and a molecular weight of 442.48 g/mol. Its IUPAC name is N-[(E)-[1-(2-methoxy-4-nitrophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]naphthalene-2-carboxamide.
| Compound Name | N-[(E)-[1-(2-methoxy-4-nitrophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 126008480 |
| Molecular Formula | C25H22N4O4 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | N-[(E)-[1-(2-methoxy-4-nitrophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]naphthalene-2-carboxamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1-n1c(C)cc(/C=N/NC(=O)c2ccc3ccccc3c2)c1C |
| InChI | InChI=1S/C25H22N4O4/c1-16-12-21(17(2)28(16)23-11-10-22(29(31)32)14-24(23)33-3)15-26-27-25(30)20-9-8-18-6-4-5-7-19(18)13-20/h4-15H,1-3H3,(H,27,30)/b26-15+ |
| InChIKey | XFXMLIYHIBVHBB-CVKSISIWSA-N |
| XLogP | 4.93 |
| TPSA | 98.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|