C24H20BrN3O — CID 29147022
2-bromo-N-[(Z)-(2,5-dimethyl-1-naphthalen-1-ylpyrrol-3-yl)methylideneamino]benzamide (PubChem CID 29147022) has the molecular formula C24H20BrN3O and a molecular weight of 446.35 g/mol. Its IUPAC name is 2-bromo-N-[(Z)-(2,5-dimethyl-1-naphthalen-1-ylpyrrol-3-yl)methylideneamino]benzamide.
| Compound Name | 2-bromo-N-[(Z)-(2,5-dimethyl-1-naphthalen-1-ylpyrrol-3-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 29147022 |
| Molecular Formula | C24H20BrN3O |
| Molecular Weight | 446.35 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | 2-bromo-N-[(Z)-(2,5-dimethyl-1-naphthalen-1-ylpyrrol-3-yl)methylideneamino]benzamide |
| SMILES | Cc1cc(/C=N\NC(=O)c2ccccc2Br)c(C)n1-c1cccc2ccccc12 |
| InChI | InChI=1S/C24H20BrN3O/c1-16-14-19(15-26-27-24(29)21-11-5-6-12-22(21)25)17(2)28(16)23-13-7-9-18-8-3-4-10-20(18)23/h3-15H,1-2H3,(H,27,29)/b26-15- |
| InChIKey | HPKVPZGNFZLQQS-YSMPRRRNSA-N |
| XLogP | 5.77 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.35 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|