C31H27N3O — CID 126395032
N-[(Z)-(2,5-dimethyl-1-naphthalen-1-ylpyrrol-3-yl)methylideneamino]-2,2-diphenylacetamide (PubChem CID 126395032) has the molecular formula C31H27N3O and a molecular weight of 457.58 g/mol. Its IUPAC name is N-[(Z)-(2,5-dimethyl-1-naphthalen-1-ylpyrrol-3-yl)methylideneamino]-2,2-diphenylacetamide.
| Compound Name | N-[(Z)-(2,5-dimethyl-1-naphthalen-1-ylpyrrol-3-yl)methylideneamino]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 126395032 |
| Molecular Formula | C31H27N3O |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | N-[(Z)-(2,5-dimethyl-1-naphthalen-1-ylpyrrol-3-yl)methylideneamino]-2,2-diphenylacetamide |
| SMILES | Cc1cc(/C=N\NC(=O)C(c2ccccc2)c2ccccc2)c(C)n1-c1cccc2ccccc12 |
| InChI | InChI=1S/C31H27N3O/c1-22-20-27(23(2)34(22)29-19-11-17-24-12-9-10-18-28(24)29)21-32-33-31(35)30(25-13-5-3-6-14-25)26-15-7-4-8-16-26/h3-21,30H,1-2H3,(H,33,35)/b32-21- |
| InChIKey | DEEKYVSOGZRUAC-QXPFVDMISA-N |
| XLogP | 6.53 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|