C36H29ClN4O2 — CID 126043055
N-[(Z)-[1-[4-[(2-chlorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-phenylquinoline-4-carboxamide (PubChem CID 126043055) has the molecular formula C36H29ClN4O2 and a molecular weight of 585.11 g/mol. Its IUPAC name is N-[(Z)-[1-[4-[(2-chlorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-phenylquinoline-4-carboxamide.
| Compound Name | N-[(Z)-[1-[4-[(2-chlorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 126043055 |
| Molecular Formula | C36H29ClN4O2 |
| Molecular Weight | 585.11 g/mol |
| Exact Mass | 584.20 |
| IUPAC Name | N-[(Z)-[1-[4-[(2-chlorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-phenylquinoline-4-carboxamide |
| SMILES | Cc1cc(/C=N\NC(=O)c2cc(-c3ccccc3)nc3ccccc23)c(C)n1-c1ccc(OCc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C36H29ClN4O2/c1-24-20-28(25(2)41(24)29-16-18-30(19-17-29)43-23-27-12-6-8-14-33(27)37)22-38-40-36(42)32-21-35(26-10-4-3-5-11-26)39-34-15-9-7-13-31(32)34/h3-22H,23H2,1-2H3,(H,40,42)/b38-22- |
| InChIKey | LYVYGYRTFYUDCI-BIKKEBSBSA-N |
| XLogP | 8.31 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.11 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|