C28H26Cl2N4O2 — CID 3361150
1-[[1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]-3-(2-methylphenyl)urea (PubChem CID 3361150) has the molecular formula C28H26Cl2N4O2 and a molecular weight of 521.45 g/mol. Its IUPAC name is 1-[[1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]-3-(2-methylphenyl)urea.
| Compound Name | 1-[[1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]-3-(2-methylphenyl)urea |
|---|---|
| PubChem CID | 3361150 |
| Molecular Formula | C28H26Cl2N4O2 |
| Molecular Weight | 521.45 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | 1-[[1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]-3-(2-methylphenyl)urea |
| SMILES | Cc1ccccc1NC(=O)NN=Cc1cc(C)n(-c2ccc(OCc3ccc(Cl)cc3Cl)cc2)c1C |
| InChI | InChI=1S/C28H26Cl2N4O2/c1-18-6-4-5-7-27(18)32-28(35)33-31-16-22-14-19(2)34(20(22)3)24-10-12-25(13-11-24)36-17-21-8-9-23(29)15-26(21)30/h4-16H,17H2,1-3H3,(H2,32,33,35) |
| InChIKey | XVMBUMPDSOOOCS-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 67.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.45 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|