C38H34Cl2N4O4 — CID 126407976
N-[(E)-[1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide (PubChem CID 126407976) has the molecular formula C38H34Cl2N4O4 and a molecular weight of 681.62 g/mol. Its IUPAC name is N-[(E)-[1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide.
| Compound Name | N-[(E)-[1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 126407976 |
| Molecular Formula | C38H34Cl2N4O4 |
| Molecular Weight | 681.62 g/mol |
| Exact Mass | 680.20 |
| IUPAC Name | N-[(E)-[1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
| SMILES | Cc1ccc(C)n1-c1ccc(OCc2ccc(C(=O)N/N=C/c3cc(C)n(-c4ccc(OCc5ccc(Cl)cc5Cl)cc4)c3C)o2)cc1 |
| InChI | InChI=1S/C38H34Cl2N4O4/c1-24-5-6-25(2)43(24)31-9-13-34(14-10-31)47-23-35-17-18-37(48-35)38(45)42-41-21-29-19-26(3)44(27(29)4)32-11-15-33(16-12-32)46-22-28-7-8-30(39)20-36(28)40/h5-21H,22-23H2,1-4H3,(H,42,45)/b41-21+ |
| InChIKey | NFYQHIHRSUMENR-LLJCYPMUSA-N |
| XLogP | 9.32 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.62 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|