C32H24Cl3N3O5 — CID 126413704
[4-chloro-2-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate (PubChem CID 126413704) has the molecular formula C32H24Cl3N3O5 and a molecular weight of 636.92 g/mol. Its IUPAC name is [4-chloro-2-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate.
| Compound Name | [4-chloro-2-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 126413704 |
| Molecular Formula | C32H24Cl3N3O5 |
| Molecular Weight | 636.92 g/mol |
| Exact Mass | 635.08 |
| IUPAC Name | [4-chloro-2-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate |
| SMILES | Cc1ccc(C)n1-c1ccc(OCc2ccc(C(=O)N/N=C/c3cc(Cl)ccc3OC(=O)c3ccc(Cl)cc3Cl)o2)cc1 |
| InChI | InChI=1S/C32H24Cl3N3O5/c1-19-3-4-20(2)38(19)24-7-9-25(10-8-24)41-18-26-11-14-30(42-26)31(39)37-36-17-21-15-22(33)6-13-29(21)43-32(40)27-12-5-23(34)16-28(27)35/h3-17H,18H2,1-2H3,(H,37,39)/b36-17+ |
| InChIKey | NYUCUZOASRGVHY-KULFSUQXSA-N |
| XLogP | 8.21 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.92 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|