C28H26ClN3O6 — CID 126409194
[4-chloro-2-[[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-6-methoxyphenyl] acetate (PubChem CID 126409194) has the molecular formula C28H26ClN3O6 and a molecular weight of 535.98 g/mol. Its IUPAC name is [4-chloro-2-[[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-6-methoxyphenyl] acetate.
| Compound Name | [4-chloro-2-[[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-6-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 126409194 |
| Molecular Formula | C28H26ClN3O6 |
| Molecular Weight | 535.98 g/mol |
| Exact Mass | 535.15 |
| IUPAC Name | [4-chloro-2-[[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-6-methoxyphenyl] acetate |
| SMILES | COc1cc(Cl)cc(C=NNC(=O)c2ccc(COc3ccc(-n4c(C)ccc4C)cc3)o2)c1OC(C)=O |
| InChI | InChI=1S/C28H26ClN3O6/c1-17-5-6-18(2)32(17)22-7-9-23(10-8-22)36-16-24-11-12-25(38-24)28(34)31-30-15-20-13-21(29)14-26(35-4)27(20)37-19(3)33/h5-15H,16H2,1-4H3,(H,31,34) |
| InChIKey | QVDOTDLLVOSPHV-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.98 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|