C33H27Cl2N3O6 — CID 126410746
[4-chloro-2-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]phenyl] 5-chloro-2-methoxybenzoate (PubChem CID 126410746) has the molecular formula C33H27Cl2N3O6 and a molecular weight of 632.50 g/mol. Its IUPAC name is [4-chloro-2-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]phenyl] 5-chloro-2-methoxybenzoate.
| Compound Name | [4-chloro-2-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]phenyl] 5-chloro-2-methoxybenzoate |
|---|---|
| PubChem CID | 126410746 |
| Molecular Formula | C33H27Cl2N3O6 |
| Molecular Weight | 632.50 g/mol |
| Exact Mass | 631.13 |
| IUPAC Name | [4-chloro-2-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]phenyl] 5-chloro-2-methoxybenzoate |
| SMILES | COc1ccc(Cl)cc1C(=O)Oc1ccc(Cl)cc1/C=N/NC(=O)c1ccc(COc2ccc(-n3c(C)ccc3C)cc2)o1 |
| InChI | InChI=1S/C33H27Cl2N3O6/c1-20-4-5-21(2)38(20)25-8-10-26(11-9-25)42-19-27-12-15-31(43-27)32(39)37-36-18-22-16-23(34)6-13-29(22)44-33(40)28-17-24(35)7-14-30(28)41-3/h4-18H,19H2,1-3H3,(H,37,39)/b36-18+ |
| InChIKey | BTKGLEAUJPCJCD-IZYHBKOJSA-N |
| XLogP | 7.56 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.50 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|