C33H28Cl2N4O5 — CID 126406892
N-[(E)-[5-chloro-2-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide (PubChem CID 126406892) has the molecular formula C33H28Cl2N4O5 and a molecular weight of 631.52 g/mol. Its IUPAC name is N-[(E)-[5-chloro-2-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide.
| Compound Name | N-[(E)-[5-chloro-2-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 126406892 |
| Molecular Formula | C33H28Cl2N4O5 |
| Molecular Weight | 631.52 g/mol |
| Exact Mass | 630.14 |
| IUPAC Name | N-[(E)-[5-chloro-2-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
| SMILES | Cc1ccc(C)n1-c1ccc(OCc2ccc(C(=O)N/N=C/c3cc(Cl)ccc3OCC(=O)Nc3ccc(Cl)cc3)o2)cc1 |
| InChI | InChI=1S/C33H28Cl2N4O5/c1-21-3-4-22(2)39(21)27-10-12-28(13-11-27)42-19-29-14-16-31(44-29)33(41)38-36-18-23-17-25(35)7-15-30(23)43-20-32(40)37-26-8-5-24(34)6-9-26/h3-18H,19-20H2,1-2H3,(H,37,40)(H,38,41)/b36-18+ |
| InChIKey | KAIACARQPWCCAJ-IZYHBKOJSA-N |
| XLogP | 7.35 |
| TPSA | 107.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.52 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|