C34H31BrN4O6 — CID 126411322
N-[(E)-[4-(2-anilino-2-oxoethoxy)-2-bromo-5-methoxyphenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide (PubChem CID 126411322) has the molecular formula C34H31BrN4O6 and a molecular weight of 671.55 g/mol. Its IUPAC name is N-[(E)-[4-(2-anilino-2-oxoethoxy)-2-bromo-5-methoxyphenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide.
| Compound Name | N-[(E)-[4-(2-anilino-2-oxoethoxy)-2-bromo-5-methoxyphenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 126411322 |
| Molecular Formula | C34H31BrN4O6 |
| Molecular Weight | 671.55 g/mol |
| Exact Mass | 670.14 |
| IUPAC Name | N-[(E)-[4-(2-anilino-2-oxoethoxy)-2-bromo-5-methoxyphenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
| SMILES | COc1cc(/C=N/NC(=O)c2ccc(COc3ccc(-n4c(C)ccc4C)cc3)o2)c(Br)cc1OCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C34H31BrN4O6/c1-22-9-10-23(2)39(22)26-11-13-27(14-12-26)43-20-28-15-16-30(45-28)34(41)38-36-19-24-17-31(42-3)32(18-29(24)35)44-21-33(40)37-25-7-5-4-6-8-25/h4-19H,20-21H2,1-3H3,(H,37,40)(H,38,41)/b36-19+ |
| InChIKey | YABDEGOGNNTQDR-ODNPBWNPSA-N |
| XLogP | 6.82 |
| TPSA | 116.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.55 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|