C35H34BrN3O5 — CID 126405124
N-[(E)-[2-bromo-5-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide (PubChem CID 126405124) has the molecular formula C35H34BrN3O5 and a molecular weight of 656.58 g/mol. Its IUPAC name is N-[(E)-[2-bromo-5-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide.
| Compound Name | N-[(E)-[2-bromo-5-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 126405124 |
| Molecular Formula | C35H34BrN3O5 |
| Molecular Weight | 656.58 g/mol |
| Exact Mass | 655.17 |
| IUPAC Name | N-[(E)-[2-bromo-5-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
| SMILES | CCOc1cc(/C=N/NC(=O)c2ccc(COc3ccc(-n4c(C)ccc4C)cc3)o2)c(Br)cc1OCc1cccc(C)c1 |
| InChI | InChI=1S/C35H34BrN3O5/c1-5-41-33-18-27(31(36)19-34(33)43-21-26-8-6-7-23(2)17-26)20-37-38-35(40)32-16-15-30(44-32)22-42-29-13-11-28(12-14-29)39-24(3)9-10-25(39)4/h6-20H,5,21-22H2,1-4H3,(H,38,40)/b37-20+ |
| InChIKey | DRCVDQJLGDFACE-HASSKWOGSA-N |
| XLogP | 8.08 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.58 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|