C35H31Br2N3O7 — CID 126404732
3-[[2,3-dibromo-4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-6-ethoxyphenoxy]methyl]benzoic acid (PubChem CID 126404732) has the molecular formula C35H31Br2N3O7 and a molecular weight of 765.45 g/mol. Its IUPAC name is 3-[[2,3-dibromo-4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-6-ethoxyphenoxy]methyl]benzoic acid.
| Compound Name | 3-[[2,3-dibromo-4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-6-ethoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126404732 |
| Molecular Formula | C35H31Br2N3O7 |
| Molecular Weight | 765.45 g/mol |
| Exact Mass | 763.05 |
| IUPAC Name | 3-[[2,3-dibromo-4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-6-ethoxyphenoxy]methyl]benzoic acid |
| SMILES | CCOc1cc(/C=N/NC(=O)c2ccc(COc3ccc(-n4c(C)ccc4C)cc3)o2)c(Br)c(Br)c1OCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C35H31Br2N3O7/c1-4-44-30-17-25(31(36)32(37)33(30)46-19-23-6-5-7-24(16-23)35(42)43)18-38-39-34(41)29-15-14-28(47-29)20-45-27-12-10-26(11-13-27)40-21(2)8-9-22(40)3/h5-18H,4,19-20H2,1-3H3,(H,39,41)(H,42,43)/b38-18+ |
| InChIKey | BYMOEMGWTOXLEC-CDLBOOTPSA-N |
| XLogP | 8.23 |
| TPSA | 124.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.45 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|