C37H31N3O6 — CID 126409200
3-[[1-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]naphthalen-2-yl]oxymethyl]benzoic acid (PubChem CID 126409200) has the molecular formula C37H31N3O6 and a molecular weight of 613.67 g/mol. Its IUPAC name is 3-[[1-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]naphthalen-2-yl]oxymethyl]benzoic acid.
| Compound Name | 3-[[1-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]naphthalen-2-yl]oxymethyl]benzoic acid |
|---|---|
| PubChem CID | 126409200 |
| Molecular Formula | C37H31N3O6 |
| Molecular Weight | 613.67 g/mol |
| Exact Mass | 613.22 |
| IUPAC Name | 3-[[1-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]naphthalen-2-yl]oxymethyl]benzoic acid |
| SMILES | Cc1ccc(C)n1-c1ccc(OCc2ccc(C(=O)N/N=C/c3c(OCc4cccc(C(=O)O)c4)ccc4ccccc34)o2)cc1 |
| InChI | InChI=1S/C37H31N3O6/c1-24-10-11-25(2)40(24)29-13-15-30(16-14-29)44-23-31-17-19-35(46-31)36(41)39-38-21-33-32-9-4-3-7-27(32)12-18-34(33)45-22-26-6-5-8-28(20-26)37(42)43/h3-21H,22-23H2,1-2H3,(H,39,41)(H,42,43)/b38-21+ |
| InChIKey | QVLASLRVKSTROU-BBUXEPKYSA-N |
| XLogP | 7.46 |
| TPSA | 115.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.67 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|