C35H34N4O6 — CID 126409448
4-[[5-(dimethylamino)-2-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]phenoxy]methyl]benzoic acid (PubChem CID 126409448) has the molecular formula C35H34N4O6 and a molecular weight of 606.68 g/mol. Its IUPAC name is 4-[[5-(dimethylamino)-2-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[5-(dimethylamino)-2-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126409448 |
| Molecular Formula | C35H34N4O6 |
| Molecular Weight | 606.68 g/mol |
| Exact Mass | 606.25 |
| IUPAC Name | 4-[[5-(dimethylamino)-2-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]phenoxy]methyl]benzoic acid |
| SMILES | Cc1ccc(C)n1-c1ccc(OCc2ccc(C(=O)N/N=C/c3ccc(N(C)C)cc3OCc3ccc(C(=O)O)cc3)o2)cc1 |
| InChI | InChI=1S/C35H34N4O6/c1-23-5-6-24(2)39(23)28-13-15-30(16-14-28)43-22-31-17-18-32(45-31)34(40)37-36-20-27-11-12-29(38(3)4)19-33(27)44-21-25-7-9-26(10-8-25)35(41)42/h5-20H,21-22H2,1-4H3,(H,37,40)(H,41,42)/b36-20+ |
| InChIKey | RRHHCIOOFGKWGZ-ZSNJKBEMSA-N |
| XLogP | 6.37 |
| TPSA | 118.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.68 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|