C29H31N5O5 — CID 126407729
N-[(E)-[2-(2-amino-2-oxoethoxy)-4-(dimethylamino)phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide (PubChem CID 126407729) has the molecular formula C29H31N5O5 and a molecular weight of 529.60 g/mol. Its IUPAC name is N-[(E)-[2-(2-amino-2-oxoethoxy)-4-(dimethylamino)phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide.
| Compound Name | N-[(E)-[2-(2-amino-2-oxoethoxy)-4-(dimethylamino)phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 126407729 |
| Molecular Formula | C29H31N5O5 |
| Molecular Weight | 529.60 g/mol |
| Exact Mass | 529.23 |
| IUPAC Name | N-[(E)-[2-(2-amino-2-oxoethoxy)-4-(dimethylamino)phenyl]methylideneamino]-5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carboxamide |
| SMILES | Cc1ccc(C)n1-c1ccc(OCc2ccc(C(=O)N/N=C/c3ccc(N(C)C)cc3OCC(N)=O)o2)cc1 |
| InChI | InChI=1S/C29H31N5O5/c1-19-5-6-20(2)34(19)22-9-11-24(12-10-22)37-17-25-13-14-26(39-25)29(36)32-31-16-21-7-8-23(33(3)4)15-27(21)38-18-28(30)35/h5-16H,17-18H2,1-4H3,(H2,30,35)(H,32,36)/b31-16+ |
| InChIKey | MHSVCFSZWYIIFB-WCMJOSRZSA-N |
| XLogP | 3.96 |
| TPSA | 124.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.60 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|