C27H24IN3O6 — CID 126404559
2-[4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-2-iodophenoxy]acetic acid (PubChem CID 126404559) has the molecular formula C27H24IN3O6 and a molecular weight of 613.41 g/mol. Its IUPAC name is 2-[4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-2-iodophenoxy]acetic acid.
| Compound Name | 2-[4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-2-iodophenoxy]acetic acid |
|---|---|
| PubChem CID | 126404559 |
| Molecular Formula | C27H24IN3O6 |
| Molecular Weight | 613.41 g/mol |
| Exact Mass | 613.07 |
| IUPAC Name | 2-[4-[(E)-[[5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]furan-2-carbonyl]hydrazinylidene]methyl]-2-iodophenoxy]acetic acid |
| SMILES | Cc1ccc(C)n1-c1ccc(OCc2ccc(C(=O)N/N=C/c3ccc(OCC(=O)O)c(I)c3)o2)cc1 |
| InChI | InChI=1S/C27H24IN3O6/c1-17-3-4-18(2)31(17)20-6-8-21(9-7-20)35-15-22-10-12-25(37-22)27(34)30-29-14-19-5-11-24(23(28)13-19)36-16-26(32)33/h3-14H,15-16H2,1-2H3,(H,30,34)(H,32,33)/b29-14+ |
| InChIKey | AXXAMFUPJDMUKJ-IPPBACCNSA-N |
| XLogP | 5.10 |
| TPSA | 115.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.41 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|